C26H37N3O2 — CID 70362746
(6aR,9R)-4-butyl-N-(4-hydroxycyclohexyl)-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 70362746) has the molecular formula C26H37N3O2 and a molecular weight of 423.60 g/mol. Its IUPAC name is (6aR,9R)-4-butyl-N-(4-hydroxycyclohexyl)-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,9R)-4-butyl-N-(4-hydroxycyclohexyl)-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 70362746 |
| Molecular Formula | C26H37N3O2 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.29 |
| IUPAC Name | (6aR,9R)-4-butyl-N-(4-hydroxycyclohexyl)-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CCCCn1cc2c3c(cccc31)C1C[C@@H](C(=O)NC3CCC(O)CC3)CN(C)[C@@H]1C2 |
| InChI | InChI=1S/C26H37N3O2/c1-3-4-12-29-16-17-14-24-22(21-6-5-7-23(29)25(17)21)13-18(15-28(24)2)26(31)27-19-8-10-20(30)11-9-19/h5-7,16,18-20,22,24,30H,3-4,8-15H2,1-2H3,(H,27,31)/t18-,19?,20?,22?,24-/m1/s1 |
| InChIKey | APCUUBHQLXKTBY-HTTTUVACSA-N |
| XLogP | 3.82 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|