About 2-(5H-chromeno[2,3-b]pyridin-7-yl)propanoic acid;2-[4-(thiophene-2-carbonyl)phenyl]propanoic acid
2-(5H-chromeno[2,3-b]pyridin-7-yl)propanoic acid;2-[4-(thiophene-2-carbonyl)phenyl]propanoic acid (PubChem CID 70362942) has the molecular formula C29H25NO6S
and a molecular weight of 515.59 g/mol. Its IUPAC name is 2-(5H-chromeno[2,3-b]pyridin-7-yl)propanoic acid;2-[4-(thiophene-2-carbonyl)phenyl]propanoic acid.
Molecular Properties
| Compound Name | 2-(5H-chromeno[2,3-b]pyridin-7-yl)propanoic acid;2-[4-(thiophene-2-carbonyl)phenyl]propanoic acid |
| PubChem CID | 70362942 |
| Molecular Formula | C29H25NO6S |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | 2-(5H-chromeno[2,3-b]pyridin-7-yl)propanoic acid;2-[4-(thiophene-2-carbonyl)phenyl]propanoic acid |
| SMILES | CC(C(=O)O)c1ccc(C(=O)c2cccs2)cc1.CC(C(=O)O)c1ccc2c(c1)Cc1cccnc1O2 |
| InChI | InChI=1S/C15H13NO3.C14H12O3S/c1-9(15(17)18)10-4-5-13-12(7-10)8-11-3-2-6-16-14(11)19-13;1-9(14(16)17)10-4-6-11(7-5-10)13(15)12-3-2-8-18-12/h2-7,9H,8H2,1H3,(H,17,18);2-9H,1H3,(H,16,17) |
| InChIKey | AWYXGZWMWSHQFA-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 113.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(5H-chromeno[2,3-b]pyridin-7-yl)propanoic acid;2-[4-(thiophene-2-carbonyl)phenyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5H-chromeno[2,3-b]pyridin-7-yl)propanoic acid;2-[4-(thiophene-2-carbonyl)phenyl]propanoic acid?
The IUPAC name of 2-(5H-chromeno[2,3-b]pyridin-7-yl)propanoic acid;2-[4-(thiophene-2-carbonyl)phenyl]propanoic acid (CID 70362942) is 2-(5H-chromeno[2,3-b]pyridin-7-yl)propanoic acid;2-[4-(thiophene-2-carbonyl)phenyl]propanoic acid.
What is the SMILES notation for 2-(5H-chromeno[2,3-b]pyridin-7-yl)propanoic acid;2-[4-(thiophene-2-carbonyl)phenyl]propanoic acid?
The canonical SMILES for 2-(5H-chromeno[2,3-b]pyridin-7-yl)propanoic acid;2-[4-(thiophene-2-carbonyl)phenyl]propanoic acid is CC(C(=O)O)c1ccc(C(=O)c2cccs2)cc1.CC(C(=O)O)c1ccc2c(c1)Cc1cccnc1O2.
What is the InChIKey of 2-(5H-chromeno[2,3-b]pyridin-7-yl)propanoic acid;2-[4-(thiophene-2-carbonyl)phenyl]propanoic acid?
The InChIKey is AWYXGZWMWSHQFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO3.C14H12O3S/c1-9(15(17)18)10-4-5-13-12(7-10)8-11-3-2-6-16-14(11)19-13;1-9(14(16)17)10-4-6-11(7-5-10)13(15)12-3-2-8-18-12/h2-7,9H,8H2,1H3,(H,17,18);2-9H,1H3,(H,16,17).
What are the key properties of 2-(5H-chromeno[2,3-b]pyridin-7-yl)propanoic acid;2-[4-(thiophene-2-carbonyl)phenyl]propanoic acid?
2-(5H-chromeno[2,3-b]pyridin-7-yl)propanoic acid;2-[4-(thiophene-2-carbonyl)phenyl]propanoic acid has a molecular weight of 515.59 g/mol, XLogP of 6.13, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5H-chromeno[2,3-b]pyridin-7-yl)propanoic acid;2-[4-(thiophene-2-carbonyl)phenyl]propanoic acid is sourced from PubChem (CID 70362942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).