C20H27FO — CID 70362974
(1E,8R,9S,10R,13S,14S)-1-(fluoromethylidene)-10,13-dimethyl-3,6,7,8,9,11,12,14,15,16-decahydro-2H-cyclopenta[a]phenanthren-17-one (PubChem CID 70362974) has the molecular formula C20H27FO and a molecular weight of 302.43 g/mol. Its IUPAC name is (1E,8R,9S,10R,13S,14S)-1-(fluoromethylidene)-10,13-dimethyl-3,6,7,8,9,11,12,14,15,16-decahydro-2H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (1E,8R,9S,10R,13S,14S)-1-(fluoromethylidene)-10,13-dimethyl-3,6,7,8,9,11,12,14,15,16-decahydro-2H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 70362974 |
| Molecular Formula | C20H27FO |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | (1E,8R,9S,10R,13S,14S)-1-(fluoromethylidene)-10,13-dimethyl-3,6,7,8,9,11,12,14,15,16-decahydro-2H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CCC/C(=C\F)[C@@]43C)[C@@H]1CCC2=O |
| InChI | InChI=1S/C20H27FO/c1-19-11-10-17-15(16(19)8-9-18(19)22)7-6-13-4-3-5-14(12-21)20(13,17)2/h4,12,15-17H,3,5-11H2,1-2H3/b14-12+/t15-,16-,17-,19-,20+/m0/s1 |
| InChIKey | MAJVDINOVIDRRD-IFEXDLRHSA-N |
| XLogP | 5.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|