C31H53FO6 — CID 70363147
methyl 7-[(1R,2R,3R,5R)-5-fluoro-3-(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]heptanoate (PubChem CID 70363147) has the molecular formula C31H53FO6 and a molecular weight of 540.76 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5R)-5-fluoro-3-(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R,5R)-5-fluoro-3-(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 70363147 |
| Molecular Formula | C31H53FO6 |
| Molecular Weight | 540.76 g/mol |
| Exact Mass | 540.38 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5R)-5-fluoro-3-(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]heptanoate |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](CCCCCCC(=O)OC)[C@H](F)C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C31H53FO6/c1-3-4-7-14-24(37-30-17-10-12-21-35-30)19-20-26-25(15-8-5-6-9-16-29(33)34-2)27(32)23-28(26)38-31-18-11-13-22-36-31/h19-20,24-28,30-31H,3-18,21-23H2,1-2H3/b20-19+/t24-,25+,26+,27+,28+,30?,31?/m0/s1 |
| InChIKey | LYMOCMXHVHIDKY-UJXFZLHOSA-N |
| XLogP | 7.43 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.76 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|