C32H55FO4 — CID 70363413
2-[(1R,2R,3R,4R)-2-[(1E,3S)-4,7-dimethyl-3-(oxan-2-yloxy)octa-1,6-dienyl]-4-fluoro-3-heptylcyclopentyl]oxyoxane (PubChem CID 70363413) has the molecular formula C32H55FO4 and a molecular weight of 522.79 g/mol. Its IUPAC name is 2-[(1R,2R,3R,4R)-2-[(1E,3S)-4,7-dimethyl-3-(oxan-2-yloxy)octa-1,6-dienyl]-4-fluoro-3-heptylcyclopentyl]oxyoxane.
| Compound Name | 2-[(1R,2R,3R,4R)-2-[(1E,3S)-4,7-dimethyl-3-(oxan-2-yloxy)octa-1,6-dienyl]-4-fluoro-3-heptylcyclopentyl]oxyoxane |
|---|---|
| PubChem CID | 70363413 |
| Molecular Formula | C32H55FO4 |
| Molecular Weight | 522.79 g/mol |
| Exact Mass | 522.41 |
| IUPAC Name | 2-[(1R,2R,3R,4R)-2-[(1E,3S)-4,7-dimethyl-3-(oxan-2-yloxy)octa-1,6-dienyl]-4-fluoro-3-heptylcyclopentyl]oxyoxane |
| SMILES | CCCCCCC[C@@H]1[C@@H](/C=C/[C@@H](OC2CCCCO2)C(C)CC=C(C)C)[C@H](OC2CCCCO2)C[C@H]1F |
| InChI | InChI=1S/C32H55FO4/c1-5-6-7-8-9-14-26-27(30(23-28(26)33)37-32-16-11-13-22-35-32)19-20-29(25(4)18-17-24(2)3)36-31-15-10-12-21-34-31/h17,19-20,25-32H,5-16,18,21-23H2,1-4H3/b20-19+/t25?,26-,27-,28-,29-,30-,31?,32?/m1/s1 |
| InChIKey | JBBYQFLEQMJIPI-QRXGACIZSA-N |
| XLogP | 8.69 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.79 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|