C37H32N2O7 — CID 70363605
2-[(2S,4S)-4-(1,3-dioxoisoindol-2-yl)-1,5-bis(2-ethoxyphenyl)-3-oxopentan-2-yl]isoindole-1,3-dione (PubChem CID 70363605) has the molecular formula C37H32N2O7 and a molecular weight of 616.67 g/mol. Its IUPAC name is 2-[(2S,4S)-4-(1,3-dioxoisoindol-2-yl)-1,5-bis(2-ethoxyphenyl)-3-oxopentan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2S,4S)-4-(1,3-dioxoisoindol-2-yl)-1,5-bis(2-ethoxyphenyl)-3-oxopentan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 70363605 |
| Molecular Formula | C37H32N2O7 |
| Molecular Weight | 616.67 g/mol |
| Exact Mass | 616.22 |
| IUPAC Name | 2-[(2S,4S)-4-(1,3-dioxoisoindol-2-yl)-1,5-bis(2-ethoxyphenyl)-3-oxopentan-2-yl]isoindole-1,3-dione |
| SMILES | CCOc1ccccc1C[C@@H](C(=O)[C@H](Cc1ccccc1OCC)N1C(=O)c2ccccc2C1=O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C37H32N2O7/c1-3-45-31-19-11-5-13-23(31)21-29(38-34(41)25-15-7-8-16-26(25)35(38)42)33(40)30(22-24-14-6-12-20-32(24)46-4-2)39-36(43)27-17-9-10-18-28(27)37(39)44/h5-20,29-30H,3-4,21-22H2,1-2H3/t29-,30-/m0/s1 |
| InChIKey | QKTMQOWARRTALL-KYJUHHDHSA-N |
| XLogP | 5.17 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.67 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|