C41H40N2O9 — CID 70363618
2-[(2S,4S)-1,5-bis(2,5-diethoxyphenyl)-4-(1,3-dioxoisoindol-2-yl)-3-oxopentan-2-yl]isoindole-1,3-dione (PubChem CID 70363618) has the molecular formula C41H40N2O9 and a molecular weight of 704.78 g/mol. Its IUPAC name is 2-[(2S,4S)-1,5-bis(2,5-diethoxyphenyl)-4-(1,3-dioxoisoindol-2-yl)-3-oxopentan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2S,4S)-1,5-bis(2,5-diethoxyphenyl)-4-(1,3-dioxoisoindol-2-yl)-3-oxopentan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 70363618 |
| Molecular Formula | C41H40N2O9 |
| Molecular Weight | 704.78 g/mol |
| Exact Mass | 704.27 |
| IUPAC Name | 2-[(2S,4S)-1,5-bis(2,5-diethoxyphenyl)-4-(1,3-dioxoisoindol-2-yl)-3-oxopentan-2-yl]isoindole-1,3-dione |
| SMILES | CCOc1ccc(OCC)c(C[C@@H](C(=O)[C@H](Cc2cc(OCC)ccc2OCC)N2C(=O)c3ccccc3C2=O)N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C41H40N2O9/c1-5-49-27-17-19-35(51-7-3)25(21-27)23-33(42-38(45)29-13-9-10-14-30(29)39(42)46)37(44)34(43-40(47)31-15-11-12-16-32(31)41(43)48)24-26-22-28(50-6-2)18-20-36(26)52-8-4/h9-22,33-34H,5-8,23-24H2,1-4H3/t33-,34-/m0/s1 |
| InChIKey | FOUFQUXIQJCWTA-HEVIKAOCSA-N |
| XLogP | 5.97 |
| TPSA | 128.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.78 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|