C47H52N2O9 — CID 70363646
2-[1,9-bis(2,5-diethoxyphenyl)-6-(1,3-dioxoisoindol-2-yl)-2,8-dimethyl-5-oxononan-4-yl]isoindole-1,3-dione (PubChem CID 70363646) has the molecular formula C47H52N2O9 and a molecular weight of 788.94 g/mol. Its IUPAC name is 2-[1,9-bis(2,5-diethoxyphenyl)-6-(1,3-dioxoisoindol-2-yl)-2,8-dimethyl-5-oxononan-4-yl]isoindole-1,3-dione.
| Compound Name | 2-[1,9-bis(2,5-diethoxyphenyl)-6-(1,3-dioxoisoindol-2-yl)-2,8-dimethyl-5-oxononan-4-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 70363646 |
| Molecular Formula | C47H52N2O9 |
| Molecular Weight | 788.94 g/mol |
| Exact Mass | 788.37 |
| IUPAC Name | 2-[1,9-bis(2,5-diethoxyphenyl)-6-(1,3-dioxoisoindol-2-yl)-2,8-dimethyl-5-oxononan-4-yl]isoindole-1,3-dione |
| SMILES | CCOc1ccc(OCC)c(CC(C)CC(C(=O)C(CC(C)Cc2cc(OCC)ccc2OCC)N2C(=O)c3ccccc3C2=O)N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C47H52N2O9/c1-7-55-33-19-21-41(57-9-3)31(27-33)23-29(5)25-39(48-44(51)35-15-11-12-16-36(35)45(48)52)43(50)40(49-46(53)37-17-13-14-18-38(37)47(49)54)26-30(6)24-32-28-34(56-8-2)20-22-42(32)58-10-4/h11-22,27-30,39-40H,7-10,23-26H2,1-6H3 |
| InChIKey | DEVWVIACHLCXQX-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 128.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.94 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|