C41H40N2O7 — CID 70363661
2-[(2S,4S)-1,5-bis(2-butoxyphenyl)-4-(1,3-dioxoisoindol-2-yl)-3-oxopentan-2-yl]isoindole-1,3-dione (PubChem CID 70363661) has the molecular formula C41H40N2O7 and a molecular weight of 672.78 g/mol. Its IUPAC name is 2-[(2S,4S)-1,5-bis(2-butoxyphenyl)-4-(1,3-dioxoisoindol-2-yl)-3-oxopentan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2S,4S)-1,5-bis(2-butoxyphenyl)-4-(1,3-dioxoisoindol-2-yl)-3-oxopentan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 70363661 |
| Molecular Formula | C41H40N2O7 |
| Molecular Weight | 672.78 g/mol |
| Exact Mass | 672.28 |
| IUPAC Name | 2-[(2S,4S)-1,5-bis(2-butoxyphenyl)-4-(1,3-dioxoisoindol-2-yl)-3-oxopentan-2-yl]isoindole-1,3-dione |
| SMILES | CCCCOc1ccccc1C[C@@H](C(=O)[C@H](Cc1ccccc1OCCCC)N1C(=O)c2ccccc2C1=O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C41H40N2O7/c1-3-5-23-49-35-21-13-7-15-27(35)25-33(42-38(45)29-17-9-10-18-30(29)39(42)46)37(44)34(26-28-16-8-14-22-36(28)50-24-6-4-2)43-40(47)31-19-11-12-20-32(31)41(43)48/h7-22,33-34H,3-6,23-26H2,1-2H3/t33-,34-/m0/s1 |
| InChIKey | JNZPYKRKRIVHKE-HEVIKAOCSA-N |
| XLogP | 6.73 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.78 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|