About 4-(2,2-dimethylhydrazinyl)-4-oxobutanoic acid;1,1-dimethylpiperidin-1-ium
4-(2,2-dimethylhydrazinyl)-4-oxobutanoic acid;1,1-dimethylpiperidin-1-ium (PubChem CID 70363871) has the molecular formula C13H28N3O3+
and a molecular weight of 274.38 g/mol. Its IUPAC name is 4-(2,2-dimethylhydrazinyl)-4-oxobutanoic acid;1,1-dimethylpiperidin-1-ium.
Molecular Properties
| Compound Name | 4-(2,2-dimethylhydrazinyl)-4-oxobutanoic acid;1,1-dimethylpiperidin-1-ium |
| PubChem CID | 70363871 |
| Molecular Formula | C13H28N3O3+ |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | 4-(2,2-dimethylhydrazinyl)-4-oxobutanoic acid;1,1-dimethylpiperidin-1-ium |
| SMILES | CN(C)NC(=O)CCC(=O)O.C[N+]1(C)CCCCC1 |
| InChI | InChI=1S/C7H16N.C6H12N2O3/c1-8(2)6-4-3-5-7-8;1-8(2)7-5(9)3-4-6(10)11/h3-7H2,1-2H3;3-4H2,1-2H3,(H,7,9)(H,10,11)/q+1; |
| InChIKey | DTGHXUVBZYKWQN-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,2-dimethylhydrazinyl)-4-oxobutanoic acid;1,1-dimethylpiperidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-dimethylhydrazinyl)-4-oxobutanoic acid;1,1-dimethylpiperidin-1-ium?
The IUPAC name of 4-(2,2-dimethylhydrazinyl)-4-oxobutanoic acid;1,1-dimethylpiperidin-1-ium (CID 70363871) is 4-(2,2-dimethylhydrazinyl)-4-oxobutanoic acid;1,1-dimethylpiperidin-1-ium.
What is the SMILES notation for 4-(2,2-dimethylhydrazinyl)-4-oxobutanoic acid;1,1-dimethylpiperidin-1-ium?
The canonical SMILES for 4-(2,2-dimethylhydrazinyl)-4-oxobutanoic acid;1,1-dimethylpiperidin-1-ium is CN(C)NC(=O)CCC(=O)O.C[N+]1(C)CCCCC1.
What is the InChIKey of 4-(2,2-dimethylhydrazinyl)-4-oxobutanoic acid;1,1-dimethylpiperidin-1-ium?
The InChIKey is DTGHXUVBZYKWQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N.C6H12N2O3/c1-8(2)6-4-3-5-7-8;1-8(2)7-5(9)3-4-6(10)11/h3-7H2,1-2H3;3-4H2,1-2H3,(H,7,9)(H,10,11)/q+1;.
What are the key properties of 4-(2,2-dimethylhydrazinyl)-4-oxobutanoic acid;1,1-dimethylpiperidin-1-ium?
4-(2,2-dimethylhydrazinyl)-4-oxobutanoic acid;1,1-dimethylpiperidin-1-ium has a molecular weight of 274.38 g/mol, XLogP of 0.69, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dimethylhydrazinyl)-4-oxobutanoic acid;1,1-dimethylpiperidin-1-ium is sourced from PubChem (CID 70363871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).