C13H17N — CID 70364603
2-methyl-8-prop-2-enyl-6,7,8,8a-tetrahydroquinoline (PubChem CID 70364603) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 2-methyl-8-prop-2-enyl-6,7,8,8a-tetrahydroquinoline.
| Compound Name | 2-methyl-8-prop-2-enyl-6,7,8,8a-tetrahydroquinoline |
|---|---|
| PubChem CID | 70364603 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 2-methyl-8-prop-2-enyl-6,7,8,8a-tetrahydroquinoline |
| SMILES | C=CCC1CCC=C2C=CC(C)=NC21 |
| InChI | InChI=1S/C13H17N/c1-3-5-11-6-4-7-12-9-8-10(2)14-13(11)12/h3,7-9,11,13H,1,4-6H2,2H3 |
| InChIKey | HUHCCLSJMFVSFS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|