(4-phenyl-1H-pyrazol-5-yl) hydrogen carbonate

C10H8N2O3 — CID 70365113

IUPAC(4-phenyl-1H-pyrazol-5-yl) hydrogen carbonate
SMILESO=C(O)Oc1[nH]ncc1-c1ccccc1
InChIInChI=1S/C10H8N2O3/c13-10(14)15-9-8(6-11-12-9)7-4-2-1-3-5-7/h1-6H,(H,11,12)(H,13,14)
InChIKeyFHEZTTDDDRWYHO-UHFFFAOYSA-N
MW204.19 g/mol
LogP2.13
Rot. Bonds2

About (4-phenyl-1H-pyrazol-5-yl) hydrogen carbonate

(4-phenyl-1H-pyrazol-5-yl) hydrogen carbonate (PubChem CID 70365113) has the molecular formula C10H8N2O3 and a molecular weight of 204.19 g/mol. Its IUPAC name is (4-phenyl-1H-pyrazol-5-yl) hydrogen carbonate.

Molecular Properties

Compound Name(4-phenyl-1H-pyrazol-5-yl) hydrogen carbonate
PubChem CID70365113
Molecular FormulaC10H8N2O3
Molecular Weight204.19 g/mol
Exact Mass204.05
IUPAC Name(4-phenyl-1H-pyrazol-5-yl) hydrogen carbonate
SMILESO=C(O)Oc1[nH]ncc1-c1ccccc1
InChIInChI=1S/C10H8N2O3/c13-10(14)15-9-8(6-11-12-9)7-4-2-1-3-5-7/h1-6H,(H,11,12)(H,13,14)
InChIKeyFHEZTTDDDRWYHO-UHFFFAOYSA-N
XLogP2.13
TPSA75.21 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.19
LogP ≤ 52.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (4-phenyl-1H-pyrazol-5-yl) hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-phenyl-1H-pyrazol-5-yl) hydrogen carbonate?
The IUPAC name of (4-phenyl-1H-pyrazol-5-yl) hydrogen carbonate (CID 70365113) is (4-phenyl-1H-pyrazol-5-yl) hydrogen carbonate.
What is the SMILES notation for (4-phenyl-1H-pyrazol-5-yl) hydrogen carbonate?
The canonical SMILES for (4-phenyl-1H-pyrazol-5-yl) hydrogen carbonate is O=C(O)Oc1[nH]ncc1-c1ccccc1.
What is the InChIKey of (4-phenyl-1H-pyrazol-5-yl) hydrogen carbonate?
The InChIKey is FHEZTTDDDRWYHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O3/c13-10(14)15-9-8(6-11-12-9)7-4-2-1-3-5-7/h1-6H,(H,11,12)(H,13,14).
What are the key properties of (4-phenyl-1H-pyrazol-5-yl) hydrogen carbonate?
(4-phenyl-1H-pyrazol-5-yl) hydrogen carbonate has a molecular weight of 204.19 g/mol, XLogP of 2.13, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenyl-1H-pyrazol-5-yl) hydrogen carbonate is sourced from PubChem (CID 70365113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).