About [5-(3,4-dichlorophenyl)-1,3-thiazol-4-yl] hydrogen carbonate
[5-(3,4-dichlorophenyl)-1,3-thiazol-4-yl] hydrogen carbonate (PubChem CID 70365390) has the molecular formula C10H5Cl2NO3S
and a molecular weight of 290.13 g/mol. Its IUPAC name is [5-(3,4-dichlorophenyl)-1,3-thiazol-4-yl] hydrogen carbonate.
Molecular Properties
| Compound Name | [5-(3,4-dichlorophenyl)-1,3-thiazol-4-yl] hydrogen carbonate |
| PubChem CID | 70365390 |
| Molecular Formula | C10H5Cl2NO3S |
| Molecular Weight | 290.13 g/mol |
| Exact Mass | 288.94 |
| IUPAC Name | [5-(3,4-dichlorophenyl)-1,3-thiazol-4-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1ncsc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H5Cl2NO3S/c11-6-2-1-5(3-7(6)12)8-9(13-4-17-8)16-10(14)15/h1-4H,(H,14,15) |
| InChIKey | QPFRRGWWESQLDD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.13 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(3,4-dichlorophenyl)-1,3-thiazol-4-yl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(3,4-dichlorophenyl)-1,3-thiazol-4-yl] hydrogen carbonate?
The IUPAC name of [5-(3,4-dichlorophenyl)-1,3-thiazol-4-yl] hydrogen carbonate (CID 70365390) is [5-(3,4-dichlorophenyl)-1,3-thiazol-4-yl] hydrogen carbonate.
What is the SMILES notation for [5-(3,4-dichlorophenyl)-1,3-thiazol-4-yl] hydrogen carbonate?
The canonical SMILES for [5-(3,4-dichlorophenyl)-1,3-thiazol-4-yl] hydrogen carbonate is O=C(O)Oc1ncsc1-c1ccc(Cl)c(Cl)c1.
What is the InChIKey of [5-(3,4-dichlorophenyl)-1,3-thiazol-4-yl] hydrogen carbonate?
The InChIKey is QPFRRGWWESQLDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5Cl2NO3S/c11-6-2-1-5(3-7(6)12)8-9(13-4-17-8)16-10(14)15/h1-4H,(H,14,15).
What are the key properties of [5-(3,4-dichlorophenyl)-1,3-thiazol-4-yl] hydrogen carbonate?
[5-(3,4-dichlorophenyl)-1,3-thiazol-4-yl] hydrogen carbonate has a molecular weight of 290.13 g/mol, XLogP of 4.17, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(3,4-dichlorophenyl)-1,3-thiazol-4-yl] hydrogen carbonate is sourced from PubChem (CID 70365390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).