About 3-ethylporphyrin-2-amine
3-ethylporphyrin-2-amine (PubChem CID 70365468) has the molecular formula C22H17N5
and a molecular weight of 351.41 g/mol. Its IUPAC name is 3-ethylporphyrin-2-amine.
Molecular Properties
| Compound Name | 3-ethylporphyrin-2-amine |
| PubChem CID | 70365468 |
| Molecular Formula | C22H17N5 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 3-ethylporphyrin-2-amine |
| SMILES | CCC1=C(N)/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C=C3 |
| InChI | InChI=1S/C22H17N5/c1-2-19-20-11-17-7-5-15(25-17)9-13-3-4-14(24-13)10-16-6-8-18(26-16)12-21(27-20)22(19)23/h3-12H,2,23H2,1H3/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,20-11-,21-12- |
| InChIKey | GGLLJXHYYQKCKN-ICIGFYOOSA-N |
| XLogP | 3.65 |
| TPSA | 75.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-ethylporphyrin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylporphyrin-2-amine?
The IUPAC name of 3-ethylporphyrin-2-amine (CID 70365468) is 3-ethylporphyrin-2-amine.
What is the SMILES notation for 3-ethylporphyrin-2-amine?
The canonical SMILES for 3-ethylporphyrin-2-amine is CCC1=C(N)/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C=C3.
What is the InChIKey of 3-ethylporphyrin-2-amine?
The InChIKey is GGLLJXHYYQKCKN-ICIGFYOOSA-N. The full InChI is InChI=1S/C22H17N5/c1-2-19-20-11-17-7-5-15(25-17)9-13-3-4-14(24-13)10-16-6-8-18(26-16)12-21(27-20)22(19)23/h3-12H,2,23H2,1H3/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,20-11-,21-12-.
What are the key properties of 3-ethylporphyrin-2-amine?
3-ethylporphyrin-2-amine has a molecular weight of 351.41 g/mol, XLogP of 3.65, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylporphyrin-2-amine is sourced from PubChem (CID 70365468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).