C27H40FNOSi — CID 70365588
(Z,2R,5R)-5-benzyl-6-[dimethyl(2-methylpentan-2-yl)silyl]oxy-3-fluoro-1-phenylhex-3-en-2-amine (PubChem CID 70365588) has the molecular formula C27H40FNOSi and a molecular weight of 441.71 g/mol. Its IUPAC name is (Z,2R,5R)-5-benzyl-6-[dimethyl(2-methylpentan-2-yl)silyl]oxy-3-fluoro-1-phenylhex-3-en-2-amine.
| Compound Name | (Z,2R,5R)-5-benzyl-6-[dimethyl(2-methylpentan-2-yl)silyl]oxy-3-fluoro-1-phenylhex-3-en-2-amine |
|---|---|
| PubChem CID | 70365588 |
| Molecular Formula | C27H40FNOSi |
| Molecular Weight | 441.71 g/mol |
| Exact Mass | 441.29 |
| IUPAC Name | (Z,2R,5R)-5-benzyl-6-[dimethyl(2-methylpentan-2-yl)silyl]oxy-3-fluoro-1-phenylhex-3-en-2-amine |
| SMILES | CCCC(C)(C)[Si](C)(C)OC[C@@H](/C=C(\F)[C@H](N)Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C27H40FNOSi/c1-6-17-27(2,3)31(4,5)30-21-24(18-22-13-9-7-10-14-22)19-25(28)26(29)20-23-15-11-8-12-16-23/h7-16,19,24,26H,6,17-18,20-21,29H2,1-5H3/b25-19-/t24-,26-/m1/s1 |
| InChIKey | CYDRQWPKXPUSBS-UHLOBDEBSA-N |
| XLogP | 7.07 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.71 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|