C21H33FO3Si — CID 70365593
methyl (Z,4R)-4-benzyl-5-[dimethyl(2-methylpentan-2-yl)silyl]oxy-2-fluoropent-2-enoate (PubChem CID 70365593) has the molecular formula C21H33FO3Si and a molecular weight of 380.58 g/mol. Its IUPAC name is methyl (Z,4R)-4-benzyl-5-[dimethyl(2-methylpentan-2-yl)silyl]oxy-2-fluoropent-2-enoate.
| Compound Name | methyl (Z,4R)-4-benzyl-5-[dimethyl(2-methylpentan-2-yl)silyl]oxy-2-fluoropent-2-enoate |
|---|---|
| PubChem CID | 70365593 |
| Molecular Formula | C21H33FO3Si |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | methyl (Z,4R)-4-benzyl-5-[dimethyl(2-methylpentan-2-yl)silyl]oxy-2-fluoropent-2-enoate |
| SMILES | CCCC(C)(C)[Si](C)(C)OC[C@@H](/C=C(\F)C(=O)OC)Cc1ccccc1 |
| InChI | InChI=1S/C21H33FO3Si/c1-7-13-21(2,3)26(5,6)25-16-18(15-19(22)20(23)24-4)14-17-11-9-8-10-12-17/h8-12,15,18H,7,13-14,16H2,1-6H3/b19-15-/t18-/m1/s1 |
| InChIKey | LJDQQIOFEGVECG-UFSZVFTQSA-N |
| XLogP | 5.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|