About 2-[(Z,2R)-2-benzyl-4-fluoropent-3-enoxy]oxane
2-[(Z,2R)-2-benzyl-4-fluoropent-3-enoxy]oxane (PubChem CID 70365598) has the molecular formula C17H23FO2
and a molecular weight of 278.37 g/mol. Its IUPAC name is 2-[(Z,2R)-2-benzyl-4-fluoropent-3-enoxy]oxane.
Molecular Properties
| Compound Name | 2-[(Z,2R)-2-benzyl-4-fluoropent-3-enoxy]oxane |
| PubChem CID | 70365598 |
| Molecular Formula | C17H23FO2 |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2-[(Z,2R)-2-benzyl-4-fluoropent-3-enoxy]oxane |
| SMILES | C/C(F)=C/[C@H](COC1CCCCO1)Cc1ccccc1 |
| InChI | InChI=1S/C17H23FO2/c1-14(18)11-16(12-15-7-3-2-4-8-15)13-20-17-9-5-6-10-19-17/h2-4,7-8,11,16-17H,5-6,9-10,12-13H2,1H3/b14-11-/t16-,17?/m0/s1 |
| InChIKey | YDVIIDQSJKMRHA-DLZFYMDDSA-N |
| XLogP | 4.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(Z,2R)-2-benzyl-4-fluoropent-3-enoxy]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z,2R)-2-benzyl-4-fluoropent-3-enoxy]oxane?
The IUPAC name of 2-[(Z,2R)-2-benzyl-4-fluoropent-3-enoxy]oxane (CID 70365598) is 2-[(Z,2R)-2-benzyl-4-fluoropent-3-enoxy]oxane.
What is the SMILES notation for 2-[(Z,2R)-2-benzyl-4-fluoropent-3-enoxy]oxane?
The canonical SMILES for 2-[(Z,2R)-2-benzyl-4-fluoropent-3-enoxy]oxane is C/C(F)=C/[C@H](COC1CCCCO1)Cc1ccccc1.
What is the InChIKey of 2-[(Z,2R)-2-benzyl-4-fluoropent-3-enoxy]oxane?
The InChIKey is YDVIIDQSJKMRHA-DLZFYMDDSA-N. The full InChI is InChI=1S/C17H23FO2/c1-14(18)11-16(12-15-7-3-2-4-8-15)13-20-17-9-5-6-10-19-17/h2-4,7-8,11,16-17H,5-6,9-10,12-13H2,1H3/b14-11-/t16-,17?/m0/s1.
What are the key properties of 2-[(Z,2R)-2-benzyl-4-fluoropent-3-enoxy]oxane?
2-[(Z,2R)-2-benzyl-4-fluoropent-3-enoxy]oxane has a molecular weight of 278.37 g/mol, XLogP of 4.26, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z,2R)-2-benzyl-4-fluoropent-3-enoxy]oxane is sourced from PubChem (CID 70365598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).