About CID 70365615
CID 70365615 (PubChem CID 70365615) has the molecular formula C17H23NO2Si2
and a molecular weight of 329.55 g/mol.
Molecular Properties
| Compound Name | CID 70365615 |
| PubChem CID | 70365615 |
| Molecular Formula | C17H23NO2Si2 |
| Molecular Weight | 329.55 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si]Oc1cc2ccncc2cc1O[Si]C(C)(C)C |
| InChI | InChI=1S/C17H23NO2Si2/c1-16(2,3)21-19-14-9-12-7-8-18-11-13(12)10-15(14)20-22-17(4,5)6/h7-11H,1-6H3 |
| InChIKey | XGXJTALGYYREJG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 70365615 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 70365615?
The IUPAC name of CID 70365615 (CID 70365615) is not available.
What is the SMILES notation for CID 70365615?
The canonical SMILES for CID 70365615 is CC(C)(C)[Si]Oc1cc2ccncc2cc1O[Si]C(C)(C)C.
What is the InChIKey of CID 70365615?
The InChIKey is XGXJTALGYYREJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO2Si2/c1-16(2,3)21-19-14-9-12-7-8-18-11-13(12)10-15(14)20-22-17(4,5)6/h7-11H,1-6H3.
What are the key properties of CID 70365615?
CID 70365615 has a molecular weight of 329.55 g/mol, XLogP of 4.67, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 70365615 is sourced from PubChem (CID 70365615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).