C15H15ClN2O6 — CID 70365795
3-amino-4-chlorobenzoic acid;1-aminocyclohexa-3,5-diene-1,2-dicarboxylic acid (PubChem CID 70365795) has the molecular formula C15H15ClN2O6 and a molecular weight of 354.75 g/mol. Its IUPAC name is 3-amino-4-chlorobenzoic acid;1-aminocyclohexa-3,5-diene-1,2-dicarboxylic acid.
| Compound Name | 3-amino-4-chlorobenzoic acid;1-aminocyclohexa-3,5-diene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 70365795 |
| Molecular Formula | C15H15ClN2O6 |
| Molecular Weight | 354.75 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 3-amino-4-chlorobenzoic acid;1-aminocyclohexa-3,5-diene-1,2-dicarboxylic acid |
| SMILES | NC1(C(=O)O)C=CC=CC1C(=O)O.Nc1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C8H9NO4.C7H6ClNO2/c9-8(7(12)13)4-2-1-3-5(8)6(10)11;8-5-2-1-4(7(10)11)3-6(5)9/h1-5H,9H2,(H,10,11)(H,12,13);1-3H,9H2,(H,10,11) |
| InChIKey | QHYNEMMGFKPWFE-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 163.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.75 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|