About N-methyltriazolo[4,5-c]pyridin-1-amine
N-methyltriazolo[4,5-c]pyridin-1-amine (PubChem CID 70365902) has the molecular formula C6H7N5
and a molecular weight of 149.16 g/mol. Its IUPAC name is N-methyltriazolo[4,5-c]pyridin-1-amine.
Molecular Properties
| Compound Name | N-methyltriazolo[4,5-c]pyridin-1-amine |
| PubChem CID | 70365902 |
| Molecular Formula | C6H7N5 |
| Molecular Weight | 149.16 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | N-methyltriazolo[4,5-c]pyridin-1-amine |
| SMILES | CNn1nnc2cnccc21 |
| InChI | InChI=1S/C6H7N5/c1-7-11-6-2-3-8-4-5(6)9-10-11/h2-4,7H,1H3 |
| InChIKey | PMVQWITULNCENR-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.16 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyltriazolo[4,5-c]pyridin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyltriazolo[4,5-c]pyridin-1-amine?
The IUPAC name of N-methyltriazolo[4,5-c]pyridin-1-amine (CID 70365902) is N-methyltriazolo[4,5-c]pyridin-1-amine.
What is the SMILES notation for N-methyltriazolo[4,5-c]pyridin-1-amine?
The canonical SMILES for N-methyltriazolo[4,5-c]pyridin-1-amine is CNn1nnc2cnccc21.
What is the InChIKey of N-methyltriazolo[4,5-c]pyridin-1-amine?
The InChIKey is PMVQWITULNCENR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5/c1-7-11-6-2-3-8-4-5(6)9-10-11/h2-4,7H,1H3.
What are the key properties of N-methyltriazolo[4,5-c]pyridin-1-amine?
N-methyltriazolo[4,5-c]pyridin-1-amine has a molecular weight of 149.16 g/mol, XLogP of -0.00, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyltriazolo[4,5-c]pyridin-1-amine is sourced from PubChem (CID 70365902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).