C12H11Cl3FN3O — CID 70366060
4,4,4-trichloro-2-(4-fluorophenyl)-1-(2H-triazol-4-yl)butan-2-ol (PubChem CID 70366060) has the molecular formula C12H11Cl3FN3O and a molecular weight of 338.60 g/mol. Its IUPAC name is 4,4,4-trichloro-2-(4-fluorophenyl)-1-(2H-triazol-4-yl)butan-2-ol.
| Compound Name | 4,4,4-trichloro-2-(4-fluorophenyl)-1-(2H-triazol-4-yl)butan-2-ol |
|---|---|
| PubChem CID | 70366060 |
| Molecular Formula | C12H11Cl3FN3O |
| Molecular Weight | 338.60 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | 4,4,4-trichloro-2-(4-fluorophenyl)-1-(2H-triazol-4-yl)butan-2-ol |
| SMILES | OC(Cc1cn[nH]n1)(CC(Cl)(Cl)Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H11Cl3FN3O/c13-12(14,15)7-11(20,5-10-6-17-19-18-10)8-1-3-9(16)4-2-8/h1-4,6,20H,5,7H2,(H,17,18,19) |
| InChIKey | JYLJEEUPMIRNIR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.60 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|