C30H29N3O5 — CID 70366070
2-[1-[2-(oxan-2-yloxy)ethyl]-2-oxo-5-phenyl-4,5-dihydro-3H-1,4-benzodiazepin-3-yl]isoindole-1,3-dione (PubChem CID 70366070) has the molecular formula C30H29N3O5 and a molecular weight of 511.58 g/mol. Its IUPAC name is 2-[1-[2-(oxan-2-yloxy)ethyl]-2-oxo-5-phenyl-4,5-dihydro-3H-1,4-benzodiazepin-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-[2-(oxan-2-yloxy)ethyl]-2-oxo-5-phenyl-4,5-dihydro-3H-1,4-benzodiazepin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 70366070 |
| Molecular Formula | C30H29N3O5 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | 2-[1-[2-(oxan-2-yloxy)ethyl]-2-oxo-5-phenyl-4,5-dihydro-3H-1,4-benzodiazepin-3-yl]isoindole-1,3-dione |
| SMILES | O=C1C(N2C(=O)c3ccccc3C2=O)NC(c2ccccc2)c2ccccc2N1CCOC1CCCCO1 |
| InChI | InChI=1S/C30H29N3O5/c34-28-21-12-4-5-13-22(21)29(35)33(28)27-30(36)32(17-19-38-25-16-8-9-18-37-25)24-15-7-6-14-23(24)26(31-27)20-10-2-1-3-11-20/h1-7,10-15,25-27,31H,8-9,16-19H2 |
| InChIKey | SFKWKFPXQVGJSY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|