6-chloro-3,4,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid

C7H4ClF3O2 — CID 70366334

IUPAC6-chloro-3,4,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid
SMILESO=C(O)C1C=C(F)C(F)=CC1(F)Cl
InChIInChI=1S/C7H4ClF3O2/c8-7(11)2-5(10)4(9)1-3(7)6(12)13/h1-3H,(H,12,13)
InChIKeyYEJUCGQDLOKORT-UHFFFAOYSA-N
MW212.55 g/mol
LogP2.31
Rot. Bonds1

About 6-chloro-3,4,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid

6-chloro-3,4,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 70366334) has the molecular formula C7H4ClF3O2 and a molecular weight of 212.55 g/mol. Its IUPAC name is 6-chloro-3,4,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid.

Molecular Properties

Compound Name6-chloro-3,4,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid
PubChem CID70366334
Molecular FormulaC7H4ClF3O2
Molecular Weight212.55 g/mol
Exact Mass211.99
IUPAC Name6-chloro-3,4,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid
SMILESO=C(O)C1C=C(F)C(F)=CC1(F)Cl
InChIInChI=1S/C7H4ClF3O2/c8-7(11)2-5(10)4(9)1-3(7)6(12)13/h1-3H,(H,12,13)
InChIKeyYEJUCGQDLOKORT-UHFFFAOYSA-N
XLogP2.31
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.55
LogP ≤ 52.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 6-chloro-3,4,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-chloro-3,4,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 6-chloro-3,4,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid (CID 70366334) is 6-chloro-3,4,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 6-chloro-3,4,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 6-chloro-3,4,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid is O=C(O)C1C=C(F)C(F)=CC1(F)Cl.
What is the InChIKey of 6-chloro-3,4,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is YEJUCGQDLOKORT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClF3O2/c8-7(11)2-5(10)4(9)1-3(7)6(12)13/h1-3H,(H,12,13).
What are the key properties of 6-chloro-3,4,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid?
6-chloro-3,4,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 212.55 g/mol, XLogP of 2.31, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3,4,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 70366334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).