C18H21N3 — CID 70366958
4,7,14-triazapentacyclo[12.6.1.02,7.08,13.017,21]henicosa-3,5,10,16,18-pentaene (PubChem CID 70366958) has the molecular formula C18H21N3 and a molecular weight of 279.39 g/mol. Its IUPAC name is 4,7,14-triazapentacyclo[12.6.1.02,7.08,13.017,21]henicosa-3,5,10,16,18-pentaene.
| Compound Name | 4,7,14-triazapentacyclo[12.6.1.02,7.08,13.017,21]henicosa-3,5,10,16,18-pentaene |
|---|---|
| PubChem CID | 70366958 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 4,7,14-triazapentacyclo[12.6.1.02,7.08,13.017,21]henicosa-3,5,10,16,18-pentaene |
| SMILES | C1=CC2=CCN3C4CC=CCC4N4C=CN=CC4C(C1)C23 |
| InChI | InChI=1S/C18H21N3/c1-2-7-16-15(6-1)20-11-9-19-12-17(20)14-5-3-4-13-8-10-21(16)18(13)14/h1-4,8-9,11-12,14-18H,5-7,10H2 |
| InChIKey | MHFQBXXCMMKRPJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|