About 4-(1,4-dihydropyridin-2-yl)-2,1,3-benzoxadiazole
4-(1,4-dihydropyridin-2-yl)-2,1,3-benzoxadiazole (PubChem CID 70367360) has the molecular formula C11H9N3O
and a molecular weight of 199.21 g/mol. Its IUPAC name is 4-(1,4-dihydropyridin-2-yl)-2,1,3-benzoxadiazole.
Molecular Properties
| Compound Name | 4-(1,4-dihydropyridin-2-yl)-2,1,3-benzoxadiazole |
| PubChem CID | 70367360 |
| Molecular Formula | C11H9N3O |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 4-(1,4-dihydropyridin-2-yl)-2,1,3-benzoxadiazole |
| SMILES | C1=CNC(c2cccc3nonc23)=CC1 |
| InChI | InChI=1S/C11H9N3O/c1-2-7-12-9(5-1)8-4-3-6-10-11(8)14-15-13-10/h2-7,12H,1H2 |
| InChIKey | UTRPMFCCOXPPCT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,4-dihydropyridin-2-yl)-2,1,3-benzoxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,4-dihydropyridin-2-yl)-2,1,3-benzoxadiazole?
The IUPAC name of 4-(1,4-dihydropyridin-2-yl)-2,1,3-benzoxadiazole (CID 70367360) is 4-(1,4-dihydropyridin-2-yl)-2,1,3-benzoxadiazole.
What is the SMILES notation for 4-(1,4-dihydropyridin-2-yl)-2,1,3-benzoxadiazole?
The canonical SMILES for 4-(1,4-dihydropyridin-2-yl)-2,1,3-benzoxadiazole is C1=CNC(c2cccc3nonc23)=CC1.
What is the InChIKey of 4-(1,4-dihydropyridin-2-yl)-2,1,3-benzoxadiazole?
The InChIKey is UTRPMFCCOXPPCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O/c1-2-7-12-9(5-1)8-4-3-6-10-11(8)14-15-13-10/h2-7,12H,1H2.
What are the key properties of 4-(1,4-dihydropyridin-2-yl)-2,1,3-benzoxadiazole?
4-(1,4-dihydropyridin-2-yl)-2,1,3-benzoxadiazole has a molecular weight of 199.21 g/mol, XLogP of 2.07, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,4-dihydropyridin-2-yl)-2,1,3-benzoxadiazole is sourced from PubChem (CID 70367360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).