C14H19NO2 — CID 70367453
(3S,3aR,6S,6aR)-N-benzyl-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-amine (PubChem CID 70367453) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is (3S,3aR,6S,6aR)-N-benzyl-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-amine.
| Compound Name | (3S,3aR,6S,6aR)-N-benzyl-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-amine |
|---|---|
| PubChem CID | 70367453 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (3S,3aR,6S,6aR)-N-benzyl-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-amine |
| SMILES | C[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2NCc1ccccc1 |
| InChI | InChI=1S/C14H19NO2/c1-10-8-16-14-12(9-17-13(10)14)15-7-11-5-3-2-4-6-11/h2-6,10,12-15H,7-9H2,1H3/t10-,12-,13+,14+/m0/s1 |
| InChIKey | FBGGSCIXKBKWJP-SCUASFONSA-N |
| XLogP | 1.58 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |