C20H24N2O2 — CID 70367454
(3aR,6S,6aR)-3-N,6-N-dibenzyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diamine (PubChem CID 70367454) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is (3aR,6S,6aR)-3-N,6-N-dibenzyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diamine.
| Compound Name | (3aR,6S,6aR)-3-N,6-N-dibenzyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diamine |
|---|---|
| PubChem CID | 70367454 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (3aR,6S,6aR)-3-N,6-N-dibenzyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diamine |
| SMILES | c1ccc(CNC2CO[C@@H]3[C@@H](NCc4ccccc4)CO[C@H]23)cc1 |
| InChI | InChI=1S/C20H24N2O2/c1-3-7-15(8-4-1)11-21-17-13-23-20-18(14-24-19(17)20)22-12-16-9-5-2-6-10-16/h1-10,17-22H,11-14H2/t17-,18?,19+,20+/m0/s1 |
| InChIKey | LXUAQOQHELUDRS-LTLCQPOLSA-N |
| XLogP | 2.10 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |