C27H29N3O4 — CID 70368435
5-hydroxy-3-(1-methoxybutan-2-yl)-1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 70368435) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is 5-hydroxy-3-(1-methoxybutan-2-yl)-1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 5-hydroxy-3-(1-methoxybutan-2-yl)-1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 70368435 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 5-hydroxy-3-(1-methoxybutan-2-yl)-1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | CCC(COC)N1CN(C2c3ccccc3CCc3ccccc32)n2ccc(=O)c(O)c2C1=O |
| InChI | InChI=1S/C27H29N3O4/c1-3-20(16-34-2)28-17-30(29-15-14-23(31)26(32)25(29)27(28)33)24-21-10-6-4-8-18(21)12-13-19-9-5-7-11-22(19)24/h4-11,14-15,20,24,32H,3,12-13,16-17H2,1-2H3 |
| InChIKey | FYDBBBBCVXPELV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |