C24H19F4N3O3S — CID 70368529
1-[(11S)-4-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-5-hydroxy-3-[(2R)-1,1,1-trifluoropropan-2-yl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 70368529) has the molecular formula C24H19F4N3O3S and a molecular weight of 505.49 g/mol. Its IUPAC name is 1-[(11S)-4-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-5-hydroxy-3-[(2R)-1,1,1-trifluoropropan-2-yl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 1-[(11S)-4-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-5-hydroxy-3-[(2R)-1,1,1-trifluoropropan-2-yl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 70368529 |
| Molecular Formula | C24H19F4N3O3S |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | 1-[(11S)-4-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-5-hydroxy-3-[(2R)-1,1,1-trifluoropropan-2-yl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | C[C@@H](N1CN([C@H]2c3ccccc3CSc3c(F)cccc32)n2ccc(=O)c(O)c2C1=O)C(F)(F)F |
| InChI | InChI=1S/C24H19F4N3O3S/c1-13(24(26,27)28)29-12-31(30-10-9-18(32)21(33)20(30)23(29)34)19-15-6-3-2-5-14(15)11-35-22-16(19)7-4-8-17(22)25/h2-10,13,19,33H,11-12H2,1H3/t13-,19+/m1/s1 |
| InChIKey | LYEXOALEOUEDNQ-YJYMSZOUSA-N |
| XLogP | 4.39 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |