C29H33N3O4 — CID 70368609
5-hydroxy-2-(3-methoxypropyl)-3-propan-2-yl-1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 70368609) has the molecular formula C29H33N3O4 and a molecular weight of 487.60 g/mol. Its IUPAC name is 5-hydroxy-2-(3-methoxypropyl)-3-propan-2-yl-1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 5-hydroxy-2-(3-methoxypropyl)-3-propan-2-yl-1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 70368609 |
| Molecular Formula | C29H33N3O4 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | 5-hydroxy-2-(3-methoxypropyl)-3-propan-2-yl-1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | COCCCC1N(C(C)C)C(=O)c2c(O)c(=O)ccn2N1C1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C29H33N3O4/c1-19(2)31-25(13-8-18-36-3)32(30-17-16-24(33)28(34)27(30)29(31)35)26-22-11-6-4-9-20(22)14-15-21-10-5-7-12-23(21)26/h4-7,9-12,16-17,19,25-26,34H,8,13-15,18H2,1-3H3 |
| InChIKey | OCVQZPOWELRVPQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|