C23H19ClF3N3O3 — CID 70368658
1-[(3-chlorophenyl)-phenylmethyl]-5-hydroxy-3-(1,1,1-trifluoropropan-2-yl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 70368658) has the molecular formula C23H19ClF3N3O3 and a molecular weight of 477.87 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)-phenylmethyl]-5-hydroxy-3-(1,1,1-trifluoropropan-2-yl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 1-[(3-chlorophenyl)-phenylmethyl]-5-hydroxy-3-(1,1,1-trifluoropropan-2-yl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 70368658 |
| Molecular Formula | C23H19ClF3N3O3 |
| Molecular Weight | 477.87 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | 1-[(3-chlorophenyl)-phenylmethyl]-5-hydroxy-3-(1,1,1-trifluoropropan-2-yl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | CC(N1CN(C(c2ccccc2)c2cccc(Cl)c2)n2ccc(=O)c(O)c2C1=O)C(F)(F)F |
| InChI | InChI=1S/C23H19ClF3N3O3/c1-14(23(25,26)27)28-13-30(29-11-10-18(31)21(32)20(29)22(28)33)19(15-6-3-2-4-7-15)16-8-5-9-17(24)12-16/h2-12,14,19,32H,13H2,1H3 |
| InChIKey | HLCKVFJRGDPKRO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.87 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |