C24H21F2N3O3S — CID 70368742
3-(1,3-difluoropropan-2-yl)-1-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 70368742) has the molecular formula C24H21F2N3O3S and a molecular weight of 469.51 g/mol. Its IUPAC name is 3-(1,3-difluoropropan-2-yl)-1-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 3-(1,3-difluoropropan-2-yl)-1-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 70368742 |
| Molecular Formula | C24H21F2N3O3S |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 3-(1,3-difluoropropan-2-yl)-1-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | O=C1c2c(O)c(=O)ccn2N(C2c3ccccc3CSc3ccccc32)CN1C(CF)CF |
| InChI | InChI=1S/C24H21F2N3O3S/c25-11-16(12-26)27-14-29(28-10-9-19(30)23(31)22(28)24(27)32)21-17-6-2-1-5-15(17)13-33-20-8-4-3-7-18(20)21/h1-10,16,21,31H,11-14H2 |
| InChIKey | HGWAJPTZZPJUIT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |