C24H29F3N2O5 — CID 70369102
benzyl (2S)-2-(2-anilinopropanoylamino)-4-methylpentanoate;2,2,2-trifluoroacetic acid (PubChem CID 70369102) has the molecular formula C24H29F3N2O5 and a molecular weight of 482.50 g/mol. Its IUPAC name is benzyl (2S)-2-(2-anilinopropanoylamino)-4-methylpentanoate;2,2,2-trifluoroacetic acid.
| Compound Name | benzyl (2S)-2-(2-anilinopropanoylamino)-4-methylpentanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70369102 |
| Molecular Formula | C24H29F3N2O5 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | benzyl (2S)-2-(2-anilinopropanoylamino)-4-methylpentanoate;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)C[C@H](NC(=O)C(C)Nc1ccccc1)C(=O)OCc1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H28N2O3.C2HF3O2/c1-16(2)14-20(22(26)27-15-18-10-6-4-7-11-18)24-21(25)17(3)23-19-12-8-5-9-13-19;3-2(4,5)1(6)7/h4-13,16-17,20,23H,14-15H2,1-3H3,(H,24,25);(H,6,7)/t17?,20-;/m0./s1 |
| InChIKey | NGXFESJDGBTLQY-FWCANSBWSA-N |
| XLogP | 4.39 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |