C37H52O7S — CID 70369712
[3-[(Z)-2-[(1R,3aR,7aR)-1-[(2S)-3-(benzenesulfonyl)-5-hydroxy-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-yl]ethenyl]-1-acetyloxy-2-methylcyclohex-2-en-1-yl] acetate (PubChem CID 70369712) has the molecular formula C37H52O7S and a molecular weight of 640.88 g/mol. Its IUPAC name is [3-[(Z)-2-[(1R,3aR,7aR)-1-[(2S)-3-(benzenesulfonyl)-5-hydroxy-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-yl]ethenyl]-1-acetyloxy-2-methylcyclohex-2-en-1-yl] acetate.
| Compound Name | [3-[(Z)-2-[(1R,3aR,7aR)-1-[(2S)-3-(benzenesulfonyl)-5-hydroxy-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-yl]ethenyl]-1-acetyloxy-2-methylcyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 70369712 |
| Molecular Formula | C37H52O7S |
| Molecular Weight | 640.88 g/mol |
| Exact Mass | 640.34 |
| IUPAC Name | [3-[(Z)-2-[(1R,3aR,7aR)-1-[(2S)-3-(benzenesulfonyl)-5-hydroxy-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-yl]ethenyl]-1-acetyloxy-2-methylcyclohex-2-en-1-yl] acetate |
| SMILES | CC(=O)OC1(OC(C)=O)CCCC(/C=C\C2=CCC[C@]3(C)[C@@H]([C@H](C)C(CC(O)C(C)C)S(=O)(=O)c4ccccc4)CC[C@@H]23)=C1C |
| InChI | InChI=1S/C37H52O7S/c1-24(2)34(40)23-35(45(41,42)31-15-9-8-10-16-31)25(3)32-19-20-33-30(14-11-21-36(32,33)7)18-17-29-13-12-22-37(26(29)4,43-27(5)38)44-28(6)39/h8-10,14-18,24-25,32-35,40H,11-13,19-23H2,1-7H3/b18-17-/t25-,32+,33-,34?,35?,36+/m0/s1 |
| InChIKey | WYOXFIHSFBZUHV-KQWXQWMUSA-N |
| XLogP | 7.50 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.88 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|