About benzyl 3,6-diamino-5,5-difluoro-4-hydroxy-2-(4-nitrophenyl)hexanoate
benzyl 3,6-diamino-5,5-difluoro-4-hydroxy-2-(4-nitrophenyl)hexanoate (PubChem CID 70369873) has the molecular formula C19H21F2N3O5
and a molecular weight of 409.39 g/mol. Its IUPAC name is benzyl 3,6-diamino-5,5-difluoro-4-hydroxy-2-(4-nitrophenyl)hexanoate.
Molecular Properties
| Compound Name | benzyl 3,6-diamino-5,5-difluoro-4-hydroxy-2-(4-nitrophenyl)hexanoate |
| PubChem CID | 70369873 |
| Molecular Formula | C19H21F2N3O5 |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | benzyl 3,6-diamino-5,5-difluoro-4-hydroxy-2-(4-nitrophenyl)hexanoate |
| SMILES | NCC(F)(F)C(O)C(N)C(C(=O)OCc1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H21F2N3O5/c20-19(21,11-22)17(25)16(23)15(13-6-8-14(9-7-13)24(27)28)18(26)29-10-12-4-2-1-3-5-12/h1-9,15-17,25H,10-11,22-23H2 |
| InChIKey | DDYHZQXWQIMLSV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 141.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzyl 3,6-diamino-5,5-difluoro-4-hydroxy-2-(4-nitrophenyl)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 3,6-diamino-5,5-difluoro-4-hydroxy-2-(4-nitrophenyl)hexanoate?
The IUPAC name of benzyl 3,6-diamino-5,5-difluoro-4-hydroxy-2-(4-nitrophenyl)hexanoate (CID 70369873) is benzyl 3,6-diamino-5,5-difluoro-4-hydroxy-2-(4-nitrophenyl)hexanoate.
What is the SMILES notation for benzyl 3,6-diamino-5,5-difluoro-4-hydroxy-2-(4-nitrophenyl)hexanoate?
The canonical SMILES for benzyl 3,6-diamino-5,5-difluoro-4-hydroxy-2-(4-nitrophenyl)hexanoate is NCC(F)(F)C(O)C(N)C(C(=O)OCc1ccccc1)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of benzyl 3,6-diamino-5,5-difluoro-4-hydroxy-2-(4-nitrophenyl)hexanoate?
The InChIKey is DDYHZQXWQIMLSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21F2N3O5/c20-19(21,11-22)17(25)16(23)15(13-6-8-14(9-7-13)24(27)28)18(26)29-10-12-4-2-1-3-5-12/h1-9,15-17,25H,10-11,22-23H2.
What are the key properties of benzyl 3,6-diamino-5,5-difluoro-4-hydroxy-2-(4-nitrophenyl)hexanoate?
benzyl 3,6-diamino-5,5-difluoro-4-hydroxy-2-(4-nitrophenyl)hexanoate has a molecular weight of 409.39 g/mol, XLogP of 1.70, 9 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3,6-diamino-5,5-difluoro-4-hydroxy-2-(4-nitrophenyl)hexanoate is sourced from PubChem (CID 70369873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).