C36H44F2N4O3S — CID 70369966
3-[5-[[4,5-bis(2-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]pentyl]-1-(2,4-difluorophenyl)-1-heptylurea (PubChem CID 70369966) has the molecular formula C36H44F2N4O3S and a molecular weight of 650.84 g/mol. Its IUPAC name is 3-[5-[[4,5-bis(2-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]pentyl]-1-(2,4-difluorophenyl)-1-heptylurea.
| Compound Name | 3-[5-[[4,5-bis(2-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]pentyl]-1-(2,4-difluorophenyl)-1-heptylurea |
|---|---|
| PubChem CID | 70369966 |
| Molecular Formula | C36H44F2N4O3S |
| Molecular Weight | 650.84 g/mol |
| Exact Mass | 650.31 |
| IUPAC Name | 3-[5-[[4,5-bis(2-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]pentyl]-1-(2,4-difluorophenyl)-1-heptylurea |
| SMILES | CCCCCCCN(C(=O)NCCCCCSc1nc(-c2ccccc2OC)c(-c2ccccc2OC)[nH]1)c1ccc(F)cc1F |
| InChI | InChI=1S/C36H44F2N4O3S/c1-4-5-6-7-14-23-42(30-21-20-26(37)25-29(30)38)36(43)39-22-13-8-15-24-46-35-40-33(27-16-9-11-18-31(27)44-2)34(41-35)28-17-10-12-19-32(28)45-3/h9-12,16-21,25H,4-8,13-15,22-24H2,1-3H3,(H,39,43)(H,40,41) |
| InChIKey | XRJIZAVCKYSDKF-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.84 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|