About 4-ethenyl-5-methyl-3-[(Z)-prop-1-enyl]-1,5-dihydro-2-benzoxepine
4-ethenyl-5-methyl-3-[(Z)-prop-1-enyl]-1,5-dihydro-2-benzoxepine (PubChem CID 70370119) has the molecular formula C16H18O
and a molecular weight of 226.32 g/mol. Its IUPAC name is 4-ethenyl-5-methyl-3-[(Z)-prop-1-enyl]-1,5-dihydro-2-benzoxepine.
Molecular Properties
| Compound Name | 4-ethenyl-5-methyl-3-[(Z)-prop-1-enyl]-1,5-dihydro-2-benzoxepine |
| PubChem CID | 70370119 |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 4-ethenyl-5-methyl-3-[(Z)-prop-1-enyl]-1,5-dihydro-2-benzoxepine |
| SMILES | C=CC1=C(/C=C\C)OCc2ccccc2C1C |
| InChI | InChI=1S/C16H18O/c1-4-8-16-14(5-2)12(3)15-10-7-6-9-13(15)11-17-16/h4-10,12H,2,11H2,1,3H3/b8-4- |
| InChIKey | VMIPBKFRYUAHIO-YWEYNIOJSA-N |
| XLogP | 4.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethenyl-5-methyl-3-[(Z)-prop-1-enyl]-1,5-dihydro-2-benzoxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-5-methyl-3-[(Z)-prop-1-enyl]-1,5-dihydro-2-benzoxepine?
The IUPAC name of 4-ethenyl-5-methyl-3-[(Z)-prop-1-enyl]-1,5-dihydro-2-benzoxepine (CID 70370119) is 4-ethenyl-5-methyl-3-[(Z)-prop-1-enyl]-1,5-dihydro-2-benzoxepine.
What is the SMILES notation for 4-ethenyl-5-methyl-3-[(Z)-prop-1-enyl]-1,5-dihydro-2-benzoxepine?
The canonical SMILES for 4-ethenyl-5-methyl-3-[(Z)-prop-1-enyl]-1,5-dihydro-2-benzoxepine is C=CC1=C(/C=C\C)OCc2ccccc2C1C.
What is the InChIKey of 4-ethenyl-5-methyl-3-[(Z)-prop-1-enyl]-1,5-dihydro-2-benzoxepine?
The InChIKey is VMIPBKFRYUAHIO-YWEYNIOJSA-N. The full InChI is InChI=1S/C16H18O/c1-4-8-16-14(5-2)12(3)15-10-7-6-9-13(15)11-17-16/h4-10,12H,2,11H2,1,3H3/b8-4-.
What are the key properties of 4-ethenyl-5-methyl-3-[(Z)-prop-1-enyl]-1,5-dihydro-2-benzoxepine?
4-ethenyl-5-methyl-3-[(Z)-prop-1-enyl]-1,5-dihydro-2-benzoxepine has a molecular weight of 226.32 g/mol, XLogP of 4.34, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-5-methyl-3-[(Z)-prop-1-enyl]-1,5-dihydro-2-benzoxepine is sourced from PubChem (CID 70370119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).