C23H27N3O4 — CID 70370182
acetic acid;1-[[(1R,2R,3R,4R)-3-benzyl-7-oxabicyclo[2.2.1]heptan-2-yl]methylideneamino]-3-phenylurea (PubChem CID 70370182) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is acetic acid;1-[[(1R,2R,3R,4R)-3-benzyl-7-oxabicyclo[2.2.1]heptan-2-yl]methylideneamino]-3-phenylurea.
| Compound Name | acetic acid;1-[[(1R,2R,3R,4R)-3-benzyl-7-oxabicyclo[2.2.1]heptan-2-yl]methylideneamino]-3-phenylurea |
|---|---|
| PubChem CID | 70370182 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | acetic acid;1-[[(1R,2R,3R,4R)-3-benzyl-7-oxabicyclo[2.2.1]heptan-2-yl]methylideneamino]-3-phenylurea |
| SMILES | CC(=O)O.O=C(NN=C[C@H]1[C@@H](Cc2ccccc2)[C@H]2CC[C@H]1O2)Nc1ccccc1 |
| InChI | InChI=1S/C21H23N3O2.C2H4O2/c25-21(23-16-9-5-2-6-10-16)24-22-14-18-17(19-11-12-20(18)26-19)13-15-7-3-1-4-8-15;1-2(3)4/h1-10,14,17-20H,11-13H2,(H2,23,24,25);1H3,(H,3,4)/t17-,18+,19-,20-;/m1./s1 |
| InChIKey | XLSBAFLCUZXFPD-BOJUQBCTSA-N |
| XLogP | 3.92 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|