C14H26O — CID 70370703
5-ethoxy-4,4,6,6-tetramethyl-1,2,3,3a,5,6a-hexahydropentalene (PubChem CID 70370703) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is 5-ethoxy-4,4,6,6-tetramethyl-1,2,3,3a,5,6a-hexahydropentalene.
| Compound Name | 5-ethoxy-4,4,6,6-tetramethyl-1,2,3,3a,5,6a-hexahydropentalene |
|---|---|
| PubChem CID | 70370703 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | 5-ethoxy-4,4,6,6-tetramethyl-1,2,3,3a,5,6a-hexahydropentalene |
| SMILES | CCOC1C(C)(C)C2CCCC2C1(C)C |
| InChI | InChI=1S/C14H26O/c1-6-15-12-13(2,3)10-8-7-9-11(10)14(12,4)5/h10-12H,6-9H2,1-5H3 |
| InChIKey | OKZLKRCHIKIPJJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |