About 6-(hydroxymethyl)-6-methoxycyclohexa-2,4-dien-1-ol
6-(hydroxymethyl)-6-methoxycyclohexa-2,4-dien-1-ol (PubChem CID 70370707) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is 6-(hydroxymethyl)-6-methoxycyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 6-(hydroxymethyl)-6-methoxycyclohexa-2,4-dien-1-ol |
| PubChem CID | 70370707 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 6-(hydroxymethyl)-6-methoxycyclohexa-2,4-dien-1-ol |
| SMILES | COC1(CO)C=CC=CC1O |
| InChI | InChI=1S/C8H12O3/c1-11-8(6-9)5-3-2-4-7(8)10/h2-5,7,9-10H,6H2,1H3 |
| InChIKey | FPHLVELPHXGUMD-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(hydroxymethyl)-6-methoxycyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(hydroxymethyl)-6-methoxycyclohexa-2,4-dien-1-ol?
The IUPAC name of 6-(hydroxymethyl)-6-methoxycyclohexa-2,4-dien-1-ol (CID 70370707) is 6-(hydroxymethyl)-6-methoxycyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 6-(hydroxymethyl)-6-methoxycyclohexa-2,4-dien-1-ol?
The canonical SMILES for 6-(hydroxymethyl)-6-methoxycyclohexa-2,4-dien-1-ol is COC1(CO)C=CC=CC1O.
What is the InChIKey of 6-(hydroxymethyl)-6-methoxycyclohexa-2,4-dien-1-ol?
The InChIKey is FPHLVELPHXGUMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O3/c1-11-8(6-9)5-3-2-4-7(8)10/h2-5,7,9-10H,6H2,1H3.
What are the key properties of 6-(hydroxymethyl)-6-methoxycyclohexa-2,4-dien-1-ol?
6-(hydroxymethyl)-6-methoxycyclohexa-2,4-dien-1-ol has a molecular weight of 156.18 g/mol, XLogP of -0.15, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(hydroxymethyl)-6-methoxycyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 70370707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).