About 10-pyrrol-1-yldecane-2,5,8-triol
10-pyrrol-1-yldecane-2,5,8-triol (PubChem CID 70371185) has the molecular formula C14H25NO3
and a molecular weight of 255.36 g/mol. Its IUPAC name is 10-pyrrol-1-yldecane-2,5,8-triol.
Molecular Properties
| Compound Name | 10-pyrrol-1-yldecane-2,5,8-triol |
| PubChem CID | 70371185 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 10-pyrrol-1-yldecane-2,5,8-triol |
| SMILES | CC(O)CCC(O)CCC(O)CCn1cccc1 |
| InChI | InChI=1S/C14H25NO3/c1-12(16)4-5-13(17)6-7-14(18)8-11-15-9-2-3-10-15/h2-3,9-10,12-14,16-18H,4-8,11H2,1H3 |
| InChIKey | ZCPWQWYIBGHBDI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 10-pyrrol-1-yldecane-2,5,8-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-pyrrol-1-yldecane-2,5,8-triol?
The IUPAC name of 10-pyrrol-1-yldecane-2,5,8-triol (CID 70371185) is 10-pyrrol-1-yldecane-2,5,8-triol.
What is the SMILES notation for 10-pyrrol-1-yldecane-2,5,8-triol?
The canonical SMILES for 10-pyrrol-1-yldecane-2,5,8-triol is CC(O)CCC(O)CCC(O)CCn1cccc1.
What is the InChIKey of 10-pyrrol-1-yldecane-2,5,8-triol?
The InChIKey is ZCPWQWYIBGHBDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO3/c1-12(16)4-5-13(17)6-7-14(18)8-11-15-9-2-3-10-15/h2-3,9-10,12-14,16-18H,4-8,11H2,1H3.
What are the key properties of 10-pyrrol-1-yldecane-2,5,8-triol?
10-pyrrol-1-yldecane-2,5,8-triol has a molecular weight of 255.36 g/mol, XLogP of 1.54, 9 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-pyrrol-1-yldecane-2,5,8-triol is sourced from PubChem (CID 70371185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).