C15H19ClN2O — CID 703714
1-(4-chlorophenyl)-3-[2-(cyclohexen-1-yl)ethyl]urea (PubChem CID 703714) has the molecular formula C15H19ClN2O and a molecular weight of 278.78 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[2-(cyclohexen-1-yl)ethyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[2-(cyclohexen-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 703714 |
| Molecular Formula | C15H19ClN2O |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[2-(cyclohexen-1-yl)ethyl]urea |
| SMILES | O=C(NCCC1=CCCCC1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H19ClN2O/c16-13-6-8-14(9-7-13)18-15(19)17-11-10-12-4-2-1-3-5-12/h4,6-9H,1-3,5,10-11H2,(H2,17,18,19) |
| InChIKey | RPFQMVSKCKABRR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|