About trans-propyl (1S,4R)-4-[4-(4-ethylcyclohexyl)cyclohexyl]-1-methyl-2-oxocyclohexane-1-carboxylate
trans-propyl (1S,4R)-4-[4-(4-ethylcyclohexyl)cyclohexyl]-1-methyl-2-oxocyclohexane-1-carboxylate (PubChem CID 70371472) has the molecular formula C25H42O3
and a molecular weight of 390.61 g/mol. Its IUPAC name is trans-propyl (1S,4R)-4-[4-(4-ethylcyclohexyl)cyclohexyl]-1-methyl-2-oxocyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | trans-propyl (1S,4R)-4-[4-(4-ethylcyclohexyl)cyclohexyl]-1-methyl-2-oxocyclohexane-1-carboxylate |
| PubChem CID | 70371472 |
| Molecular Formula | C25H42O3 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | trans-propyl (1S,4R)-4-[4-(4-ethylcyclohexyl)cyclohexyl]-1-methyl-2-oxocyclohexane-1-carboxylate |
| SMILES | CCCOC(=O)[C@@]1(C)CC[C@@H](C2CCC(C3CCC(CC)CC3)CC2)CC1=O |
| InChI | InChI=1S/C25H42O3/c1-4-16-28-24(27)25(3)15-14-22(17-23(25)26)21-12-10-20(11-13-21)19-8-6-18(5-2)7-9-19/h18-22H,4-17H2,1-3H3/t18?,19?,20?,21?,22-,25+/m1/s1 |
| InChIKey | NNLZQEPJNMXSGJ-PLWAQTSVSA-N |
| XLogP | 6.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze trans-propyl (1S,4R)-4-[4-(4-ethylcyclohexyl)cyclohexyl]-1-methyl-2-oxocyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-propyl (1S,4R)-4-[4-(4-ethylcyclohexyl)cyclohexyl]-1-methyl-2-oxocyclohexane-1-carboxylate?
The IUPAC name of trans-propyl (1S,4R)-4-[4-(4-ethylcyclohexyl)cyclohexyl]-1-methyl-2-oxocyclohexane-1-carboxylate (CID 70371472) is trans-propyl (1S,4R)-4-[4-(4-ethylcyclohexyl)cyclohexyl]-1-methyl-2-oxocyclohexane-1-carboxylate.
What is the SMILES notation for trans-propyl (1S,4R)-4-[4-(4-ethylcyclohexyl)cyclohexyl]-1-methyl-2-oxocyclohexane-1-carboxylate?
The canonical SMILES for trans-propyl (1S,4R)-4-[4-(4-ethylcyclohexyl)cyclohexyl]-1-methyl-2-oxocyclohexane-1-carboxylate is CCCOC(=O)[C@@]1(C)CC[C@@H](C2CCC(C3CCC(CC)CC3)CC2)CC1=O.
What is the InChIKey of trans-propyl (1S,4R)-4-[4-(4-ethylcyclohexyl)cyclohexyl]-1-methyl-2-oxocyclohexane-1-carboxylate?
The InChIKey is NNLZQEPJNMXSGJ-PLWAQTSVSA-N. The full InChI is InChI=1S/C25H42O3/c1-4-16-28-24(27)25(3)15-14-22(17-23(25)26)21-12-10-20(11-13-21)19-8-6-18(5-2)7-9-19/h18-22H,4-17H2,1-3H3/t18?,19?,20?,21?,22-,25+/m1/s1.
What are the key properties of trans-propyl (1S,4R)-4-[4-(4-ethylcyclohexyl)cyclohexyl]-1-methyl-2-oxocyclohexane-1-carboxylate?
trans-propyl (1S,4R)-4-[4-(4-ethylcyclohexyl)cyclohexyl]-1-methyl-2-oxocyclohexane-1-carboxylate has a molecular weight of 390.61 g/mol, XLogP of 6.34, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-propyl (1S,4R)-4-[4-(4-ethylcyclohexyl)cyclohexyl]-1-methyl-2-oxocyclohexane-1-carboxylate is sourced from PubChem (CID 70371472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).