C46H78N4O8 — CID 70371657
2-O,4-O-bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 1-O,3-O-bis(1,2,2-trimethyl-6-methylidenepiperidin-4-yl) butane-1,2,3,4-tetracarboxylate (PubChem CID 70371657) has the molecular formula C46H78N4O8 and a molecular weight of 815.15 g/mol. Its IUPAC name is 2-O,4-O-bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 1-O,3-O-bis(1,2,2-trimethyl-6-methylidenepiperidin-4-yl) butane-1,2,3,4-tetracarboxylate.
| Compound Name | 2-O,4-O-bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 1-O,3-O-bis(1,2,2-trimethyl-6-methylidenepiperidin-4-yl) butane-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 70371657 |
| Molecular Formula | C46H78N4O8 |
| Molecular Weight | 815.15 g/mol |
| Exact Mass | 814.58 |
| IUPAC Name | 2-O,4-O-bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 1-O,3-O-bis(1,2,2-trimethyl-6-methylidenepiperidin-4-yl) butane-1,2,3,4-tetracarboxylate |
| SMILES | C=C1CC(OC(=O)CC(C(=O)OC2CC(C)(C)N(C)C(C)(C)C2)C(CC(=O)OC2CC(C)(C)N(C)C(C)(C)C2)C(=O)OC2CC(=C)N(C)C(C)(C)C2)CC(C)(C)N1C |
| InChI | InChI=1S/C46H78N4O8/c1-29-19-31(23-41(3,4)47(29)15)55-37(51)21-36(40(54)58-34-27-45(11,12)50(18)46(13,14)28-34)35(39(53)57-32-20-30(2)48(16)42(5,6)24-32)22-38(52)56-33-25-43(7,8)49(17)44(9,10)26-33/h31-36H,1-2,19-28H2,3-18H3 |
| InChIKey | SMXCNXWBOMGLQG-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 118.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.15 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|