About N-ethyl-N-[[(2S)-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl]methyl]ethanamine
N-ethyl-N-[[(2S)-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl]methyl]ethanamine (PubChem CID 70371674) has the molecular formula C18H27NO
and a molecular weight of 273.42 g/mol. Its IUPAC name is N-ethyl-N-[[(2S)-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-ethyl-N-[[(2S)-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl]methyl]ethanamine |
| PubChem CID | 70371674 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | N-ethyl-N-[[(2S)-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl]methyl]ethanamine |
| SMILES | CCN(CC)CC1CCCC[C@]12Cc1ccccc1O2 |
| InChI | InChI=1S/C18H27NO/c1-3-19(4-2)14-16-10-7-8-12-18(16)13-15-9-5-6-11-17(15)20-18/h5-6,9,11,16H,3-4,7-8,10,12-14H2,1-2H3/t16?,18-/m0/s1 |
| InChIKey | BTNLSMPMJWGVEM-DAFXYXGESA-N |
| XLogP | 3.89 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-N-[[(2S)-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-[[(2S)-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl]methyl]ethanamine?
The IUPAC name of N-ethyl-N-[[(2S)-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl]methyl]ethanamine (CID 70371674) is N-ethyl-N-[[(2S)-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl]methyl]ethanamine.
What is the SMILES notation for N-ethyl-N-[[(2S)-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl]methyl]ethanamine?
The canonical SMILES for N-ethyl-N-[[(2S)-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl]methyl]ethanamine is CCN(CC)CC1CCCC[C@]12Cc1ccccc1O2.
What is the InChIKey of N-ethyl-N-[[(2S)-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl]methyl]ethanamine?
The InChIKey is BTNLSMPMJWGVEM-DAFXYXGESA-N. The full InChI is InChI=1S/C18H27NO/c1-3-19(4-2)14-16-10-7-8-12-18(16)13-15-9-5-6-11-17(15)20-18/h5-6,9,11,16H,3-4,7-8,10,12-14H2,1-2H3/t16?,18-/m0/s1.
What are the key properties of N-ethyl-N-[[(2S)-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl]methyl]ethanamine?
N-ethyl-N-[[(2S)-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl]methyl]ethanamine has a molecular weight of 273.42 g/mol, XLogP of 3.89, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-[[(2S)-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl]methyl]ethanamine is sourced from PubChem (CID 70371674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).