C14H16O6 — CID 70371735
1,3,5,7-tetrakis(hydroxymethyl)naphthalene-2,6-diol (PubChem CID 70371735) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is 1,3,5,7-tetrakis(hydroxymethyl)naphthalene-2,6-diol.
| Compound Name | 1,3,5,7-tetrakis(hydroxymethyl)naphthalene-2,6-diol |
|---|---|
| PubChem CID | 70371735 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 1,3,5,7-tetrakis(hydroxymethyl)naphthalene-2,6-diol |
| SMILES | OCc1cc2c(CO)c(O)c(CO)cc2c(CO)c1O |
| InChI | InChI=1S/C14H16O6/c15-3-7-1-9-10(12(6-18)13(7)19)2-8(4-16)14(20)11(9)5-17/h1-2,15-20H,3-6H2 |
| InChIKey | KCGMLGWMJRJNFK-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |