C42H64N2O4 — CID 70372072
(3R,4R)-3,4-bis[[4-(4-pentylcyclohexyl)phenyl]methoxy]hexanediamide (PubChem CID 70372072) has the molecular formula C42H64N2O4 and a molecular weight of 660.98 g/mol. Its IUPAC name is (3R,4R)-3,4-bis[[4-(4-pentylcyclohexyl)phenyl]methoxy]hexanediamide.
| Compound Name | (3R,4R)-3,4-bis[[4-(4-pentylcyclohexyl)phenyl]methoxy]hexanediamide |
|---|---|
| PubChem CID | 70372072 |
| Molecular Formula | C42H64N2O4 |
| Molecular Weight | 660.98 g/mol |
| Exact Mass | 660.49 |
| IUPAC Name | (3R,4R)-3,4-bis[[4-(4-pentylcyclohexyl)phenyl]methoxy]hexanediamide |
| SMILES | CCCCCC1CCC(c2ccc(CO[C@H](CC(N)=O)[C@@H](CC(N)=O)OCc3ccc(C4CCC(CCCCC)CC4)cc3)cc2)CC1 |
| InChI | InChI=1S/C42H64N2O4/c1-3-5-7-9-31-11-19-35(20-12-31)37-23-15-33(16-24-37)29-47-39(27-41(43)45)40(28-42(44)46)48-30-34-17-25-38(26-18-34)36-21-13-32(14-22-36)10-8-6-4-2/h15-18,23-26,31-32,35-36,39-40H,3-14,19-22,27-30H2,1-2H3,(H2,43,45)(H2,44,46)/t31?,32?,35?,36?,39-,40-/m1/s1 |
| InChIKey | TXIVDFSDEXNXBK-AEEKLLLNSA-N |
| XLogP | 9.62 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.98 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|