C28H30O10 — CID 70372615
(7R,9R)-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-7-[(1R,3S,4R)-4-hydroxy-3-methylcyclohexyl]oxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 70372615) has the molecular formula C28H30O10 and a molecular weight of 526.54 g/mol. Its IUPAC name is (7R,9R)-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-7-[(1R,3S,4R)-4-hydroxy-3-methylcyclohexyl]oxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (7R,9R)-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-7-[(1R,3S,4R)-4-hydroxy-3-methylcyclohexyl]oxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 70372615 |
| Molecular Formula | C28H30O10 |
| Molecular Weight | 526.54 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | (7R,9R)-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-7-[(1R,3S,4R)-4-hydroxy-3-methylcyclohexyl]oxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@](O)(C(=O)CO)C[C@H]3O[C@@H]1CC[C@@H](O)[C@@H](C)C1 |
| InChI | InChI=1S/C28H30O10/c1-12-8-13(6-7-16(12)30)38-18-10-28(36,19(31)11-29)9-15-21(18)27(35)23-22(25(15)33)24(32)14-4-3-5-17(37-2)20(14)26(23)34/h3-5,12-13,16,18,29-30,33,35-36H,6-11H2,1-2H3/t12-,13+,16+,18+,28+/m0/s1 |
| InChIKey | NSOMWTGGDVEABV-LTDHSNJXSA-N |
| XLogP | 1.73 |
| TPSA | 170.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.54 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|