C23H34O5 — CID 70372755
4-[8-[2-(4-hydroxy-6-oxooxan-2-yl)ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl]-3-methylbutanoic acid (PubChem CID 70372755) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is 4-[8-[2-(4-hydroxy-6-oxooxan-2-yl)ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl]-3-methylbutanoic acid.
| Compound Name | 4-[8-[2-(4-hydroxy-6-oxooxan-2-yl)ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 70372755 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 4-[8-[2-(4-hydroxy-6-oxooxan-2-yl)ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl]-3-methylbutanoic acid |
| SMILES | CC(CC(=O)O)CC1CCC=C2C=CC(C)C(CCC3CC(O)CC(=O)O3)C21 |
| InChI | InChI=1S/C23H34O5/c1-14(11-21(25)26)10-17-5-3-4-16-7-6-15(2)20(23(16)17)9-8-19-12-18(24)13-22(27)28-19/h4,6-7,14-15,17-20,23-24H,3,5,8-13H2,1-2H3,(H,25,26) |
| InChIKey | KVAJABVNRLXCIR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |