C38H24N6O12 — CID 70372825
1-[2-(2,5-dioxopyrrol-1-yl)ethyl]pyrrole-2,5-dione;1-[3-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione;1-[4-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione (PubChem CID 70372825) has the molecular formula C38H24N6O12 and a molecular weight of 756.64 g/mol. Its IUPAC name is 1-[2-(2,5-dioxopyrrol-1-yl)ethyl]pyrrole-2,5-dione;1-[3-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione;1-[4-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[2-(2,5-dioxopyrrol-1-yl)ethyl]pyrrole-2,5-dione;1-[3-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione;1-[4-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 70372825 |
| Molecular Formula | C38H24N6O12 |
| Molecular Weight | 756.64 g/mol |
| Exact Mass | 756.15 |
| IUPAC Name | 1-[2-(2,5-dioxopyrrol-1-yl)ethyl]pyrrole-2,5-dione;1-[3-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione;1-[4-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CCN1C(=O)C=CC1=O.O=C1C=CC(=O)N1c1ccc(N2C(=O)C=CC2=O)cc1.O=C1C=CC(=O)N1c1cccc(N2C(=O)C=CC2=O)c1 |
| InChI | InChI=1S/2C14H8N2O4.C10H8N2O4/c17-11-5-6-12(18)15(11)9-1-2-10(4-3-9)16-13(19)7-8-14(16)20;17-11-4-5-12(18)15(11)9-2-1-3-10(8-9)16-13(19)6-7-14(16)20;13-7-1-2-8(14)11(7)5-6-12-9(15)3-4-10(12)16/h2*1-8H;1-4H,5-6H2 |
| InChIKey | DALIYUPLAZCUEF-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 224.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.64 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|